C24H20FN3O3 — CID 134413803
4-fluoro-7-[(3-hydroxynaphthalen-1-yl)amino]-2-(1-prop-2-enoylazetidin-3-yl)-3H-isoindol-1-one (PubChem CID 134413803) has the molecular formula C24H20FN3O3 and a molecular weight of 417.44 g/mol. Its IUPAC name is 4-fluoro-7-[(3-hydroxynaphthalen-1-yl)amino]-2-(1-prop-2-enoylazetidin-3-yl)-3H-isoindol-1-one.
| Compound Name | 4-fluoro-7-[(3-hydroxynaphthalen-1-yl)amino]-2-(1-prop-2-enoylazetidin-3-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 134413803 |
| Molecular Formula | C24H20FN3O3 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-fluoro-7-[(3-hydroxynaphthalen-1-yl)amino]-2-(1-prop-2-enoylazetidin-3-yl)-3H-isoindol-1-one |
| SMILES | C=CC(=O)N1CC(N2Cc3c(F)ccc(Nc4cc(O)cc5ccccc45)c3C2=O)C1 |
| InChI | InChI=1S/C24H20FN3O3/c1-2-22(30)27-11-15(12-27)28-13-18-19(25)7-8-20(23(18)24(28)31)26-21-10-16(29)9-14-5-3-4-6-17(14)21/h2-10,15,26,29H,1,11-13H2 |
| InChIKey | VQDWGHVJCXNKQM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|