C26H26N2O2 — CID 135271248
1-[3-[2-(3-hydroxynaphthalen-1-yl)-1,3,4,5-tetrahydro-2-benzazepin-7-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 135271248) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 1-[3-[2-(3-hydroxynaphthalen-1-yl)-1,3,4,5-tetrahydro-2-benzazepin-7-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[2-(3-hydroxynaphthalen-1-yl)-1,3,4,5-tetrahydro-2-benzazepin-7-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135271248 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1-[3-[2-(3-hydroxynaphthalen-1-yl)-1,3,4,5-tetrahydro-2-benzazepin-7-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(c2ccc3c(c2)CCCN(c2cc(O)cc4ccccc24)C3)C1 |
| InChI | InChI=1S/C26H26N2O2/c1-2-26(30)28-16-22(17-28)19-9-10-21-15-27(11-5-7-18(21)12-19)25-14-23(29)13-20-6-3-4-8-24(20)25/h2-4,6,8-10,12-14,22,29H,1,5,7,11,15-17H2 |
| InChIKey | PPFCGRQXGAPBDB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|