C26H22N2O3 — CID 135280404
1-[3-[1-acetyl-6-(3-hydroxynaphthalen-1-yl)indol-2-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 135280404) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is 1-[3-[1-acetyl-6-(3-hydroxynaphthalen-1-yl)indol-2-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[1-acetyl-6-(3-hydroxynaphthalen-1-yl)indol-2-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135280404 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 1-[3-[1-acetyl-6-(3-hydroxynaphthalen-1-yl)indol-2-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(c2cc3ccc(-c4cc(O)cc5ccccc45)cc3n2C(C)=O)C1 |
| InChI | InChI=1S/C26H22N2O3/c1-3-26(31)27-14-20(15-27)25-12-19-9-8-18(11-24(19)28(25)16(2)29)23-13-21(30)10-17-6-4-5-7-22(17)23/h3-13,20,30H,1,14-15H2,2H3 |
| InChIKey | NHCJDROYWALPBC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|