C24H20N4O2 — CID 135279102
1-[3-[[4-(3-hydroxynaphthalen-1-yl)-1,6-naphthyridin-8-yl]amino]azetidin-1-yl]prop-2-en-1-one (PubChem CID 135279102) has the molecular formula C24H20N4O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 1-[3-[[4-(3-hydroxynaphthalen-1-yl)-1,6-naphthyridin-8-yl]amino]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[4-(3-hydroxynaphthalen-1-yl)-1,6-naphthyridin-8-yl]amino]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135279102 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1-[3-[[4-(3-hydroxynaphthalen-1-yl)-1,6-naphthyridin-8-yl]amino]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(Nc2cncc3c(-c4cc(O)cc5ccccc45)ccnc23)C1 |
| InChI | InChI=1S/C24H20N4O2/c1-2-23(30)28-13-16(14-28)27-22-12-25-11-21-19(7-8-26-24(21)22)20-10-17(29)9-15-5-3-4-6-18(15)20/h2-12,16,27,29H,1,13-14H2 |
| InChIKey | VDIBVXCGOQUCRR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|