C23H19N3O3 — CID 134413106
5-(3-hydroxynaphthalen-1-yl)-2-(1-prop-2-enoylazetidin-3-yl)-1H-indazol-3-one (PubChem CID 134413106) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 5-(3-hydroxynaphthalen-1-yl)-2-(1-prop-2-enoylazetidin-3-yl)-1H-indazol-3-one.
| Compound Name | 5-(3-hydroxynaphthalen-1-yl)-2-(1-prop-2-enoylazetidin-3-yl)-1H-indazol-3-one |
|---|---|
| PubChem CID | 134413106 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 5-(3-hydroxynaphthalen-1-yl)-2-(1-prop-2-enoylazetidin-3-yl)-1H-indazol-3-one |
| SMILES | C=CC(=O)N1CC(n2[nH]c3ccc(-c4cc(O)cc5ccccc45)cc3c2=O)C1 |
| InChI | InChI=1S/C23H19N3O3/c1-2-22(28)25-12-16(13-25)26-23(29)20-10-15(7-8-21(20)24-26)19-11-17(27)9-14-5-3-4-6-18(14)19/h2-11,16,24,27H,1,12-13H2 |
| InChIKey | OIZHPMFCJBONGB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|