C26H26N2O4 — CID 134413097
tert-butyl 3-[6-(3-hydroxynaphthalen-1-yl)-3-oxo-1H-isoindol-2-yl]azetidine-1-carboxylate (PubChem CID 134413097) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is tert-butyl 3-[6-(3-hydroxynaphthalen-1-yl)-3-oxo-1H-isoindol-2-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[6-(3-hydroxynaphthalen-1-yl)-3-oxo-1H-isoindol-2-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 134413097 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | tert-butyl 3-[6-(3-hydroxynaphthalen-1-yl)-3-oxo-1H-isoindol-2-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N2Cc3cc(-c4cc(O)cc5ccccc45)ccc3C2=O)C1 |
| InChI | InChI=1S/C26H26N2O4/c1-26(2,3)32-25(31)27-14-19(15-27)28-13-18-10-17(8-9-22(18)24(28)30)23-12-20(29)11-16-6-4-5-7-21(16)23/h4-12,19,29H,13-15H2,1-3H3 |
| InChIKey | GIMPQUMPRLUACT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |