C26H25ClN4O4 — CID 126482737
tert-butyl 3-[6-amino-8-chloro-7-(3-hydroxynaphthalen-1-yl)-4-oxoquinazolin-3-yl]azetidine-1-carboxylate (PubChem CID 126482737) has the molecular formula C26H25ClN4O4 and a molecular weight of 492.96 g/mol. Its IUPAC name is tert-butyl 3-[6-amino-8-chloro-7-(3-hydroxynaphthalen-1-yl)-4-oxoquinazolin-3-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[6-amino-8-chloro-7-(3-hydroxynaphthalen-1-yl)-4-oxoquinazolin-3-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 126482737 |
| Molecular Formula | C26H25ClN4O4 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | tert-butyl 3-[6-amino-8-chloro-7-(3-hydroxynaphthalen-1-yl)-4-oxoquinazolin-3-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(n2cnc3c(Cl)c(-c4cc(O)cc5ccccc45)c(N)cc3c2=O)C1 |
| InChI | InChI=1S/C26H25ClN4O4/c1-26(2,3)35-25(34)30-11-15(12-30)31-13-29-23-19(24(31)33)10-20(28)21(22(23)27)18-9-16(32)8-14-6-4-5-7-17(14)18/h4-10,13,15,32H,11-12,28H2,1-3H3 |
| InChIKey | YWTVZOBNUMMEOS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|