C30H31ClN4O4 — CID 166817709
7-chloro-3-[3-(dimethylamino)propoxy]-6-(3-hydroxynaphthalen-1-yl)-1-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxalin-2-one (PubChem CID 166817709) has the molecular formula C30H31ClN4O4 and a molecular weight of 547.06 g/mol. Its IUPAC name is 7-chloro-3-[3-(dimethylamino)propoxy]-6-(3-hydroxynaphthalen-1-yl)-1-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxalin-2-one.
| Compound Name | 7-chloro-3-[3-(dimethylamino)propoxy]-6-(3-hydroxynaphthalen-1-yl)-1-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxalin-2-one |
|---|---|
| PubChem CID | 166817709 |
| Molecular Formula | C30H31ClN4O4 |
| Molecular Weight | 547.06 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 7-chloro-3-[3-(dimethylamino)propoxy]-6-(3-hydroxynaphthalen-1-yl)-1-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxalin-2-one |
| SMILES | C=CC(=O)N1CC(Cn2c(=O)c(OCCCN(C)C)nc3cc(-c4cc(O)cc5ccccc45)c(Cl)cc32)C1 |
| InChI | InChI=1S/C30H31ClN4O4/c1-4-28(37)34-16-19(17-34)18-35-27-15-25(31)24(23-13-21(36)12-20-8-5-6-9-22(20)23)14-26(27)32-29(30(35)38)39-11-7-10-33(2)3/h4-6,8-9,12-15,19,36H,1,7,10-11,16-18H2,2-3H3 |
| InChIKey | OKVKTEDISUVEJW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.06 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|