C35H30Cl2FN3O3 — CID 166816406
6-chloro-7-(8-chloro-7-fluoronaphthalen-1-yl)-1-(2-methyl-6-propan-2-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione (PubChem CID 166816406) has the molecular formula C35H30Cl2FN3O3 and a molecular weight of 630.55 g/mol. Its IUPAC name is 6-chloro-7-(8-chloro-7-fluoronaphthalen-1-yl)-1-(2-methyl-6-propan-2-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione.
| Compound Name | 6-chloro-7-(8-chloro-7-fluoronaphthalen-1-yl)-1-(2-methyl-6-propan-2-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 166816406 |
| Molecular Formula | C35H30Cl2FN3O3 |
| Molecular Weight | 630.55 g/mol |
| Exact Mass | 629.16 |
| IUPAC Name | 6-chloro-7-(8-chloro-7-fluoronaphthalen-1-yl)-1-(2-methyl-6-propan-2-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione |
| SMILES | C=CC(=O)N1CC(Cn2c(=O)c(=O)n(-c3c(C)cccc3C(C)C)c3cc(-c4cccc5ccc(F)c(Cl)c45)c(Cl)cc32)C1 |
| InChI | InChI=1S/C35H30Cl2FN3O3/c1-5-30(42)39-16-21(17-39)18-40-28-15-26(36)25(24-11-7-9-22-12-13-27(38)32(37)31(22)24)14-29(28)41(35(44)34(40)43)33-20(4)8-6-10-23(33)19(2)3/h5-15,19,21H,1,16-18H2,2-4H3 |
| InChIKey | NXDBCVWOGZNMAR-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.55 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|