C31H29Cl2N3O4 — CID 166816467
6-chloro-7-(2-chloro-6-hydroxyphenyl)-1-(2-methyl-6-propan-2-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione (PubChem CID 166816467) has the molecular formula C31H29Cl2N3O4 and a molecular weight of 578.50 g/mol. Its IUPAC name is 6-chloro-7-(2-chloro-6-hydroxyphenyl)-1-(2-methyl-6-propan-2-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione.
| Compound Name | 6-chloro-7-(2-chloro-6-hydroxyphenyl)-1-(2-methyl-6-propan-2-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 166816467 |
| Molecular Formula | C31H29Cl2N3O4 |
| Molecular Weight | 578.50 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | 6-chloro-7-(2-chloro-6-hydroxyphenyl)-1-(2-methyl-6-propan-2-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione |
| SMILES | C=CC(=O)N1CC(Cn2c(=O)c(=O)n(-c3c(C)cccc3C(C)C)c3cc(-c4c(O)cccc4Cl)c(Cl)cc32)C1 |
| InChI | InChI=1S/C31H29Cl2N3O4/c1-5-27(38)34-14-19(15-34)16-35-24-13-23(33)21(28-22(32)10-7-11-26(28)37)12-25(24)36(31(40)30(35)39)29-18(4)8-6-9-20(29)17(2)3/h5-13,17,19,37H,1,14-16H2,2-4H3 |
| InChIKey | UGGUAPHICPABLB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 84.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.50 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|