C27H30BrClFN3O4 — CID 157023720
tert-butyl 3-[[6-bromo-7-chloro-5-fluoro-4-(2-methyl-6-propan-2-ylphenyl)-2,3-dioxoquinoxalin-1-yl]methyl]azetidine-1-carboxylate (PubChem CID 157023720) has the molecular formula C27H30BrClFN3O4 and a molecular weight of 594.91 g/mol. Its IUPAC name is tert-butyl 3-[[6-bromo-7-chloro-5-fluoro-4-(2-methyl-6-propan-2-ylphenyl)-2,3-dioxoquinoxalin-1-yl]methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[6-bromo-7-chloro-5-fluoro-4-(2-methyl-6-propan-2-ylphenyl)-2,3-dioxoquinoxalin-1-yl]methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 157023720 |
| Molecular Formula | C27H30BrClFN3O4 |
| Molecular Weight | 594.91 g/mol |
| Exact Mass | 593.11 |
| IUPAC Name | tert-butyl 3-[[6-bromo-7-chloro-5-fluoro-4-(2-methyl-6-propan-2-ylphenyl)-2,3-dioxoquinoxalin-1-yl]methyl]azetidine-1-carboxylate |
| SMILES | Cc1cccc(C(C)C)c1-n1c(=O)c(=O)n(CC2CN(C(=O)OC(C)(C)C)C2)c2cc(Cl)c(Br)c(F)c21 |
| InChI | InChI=1S/C27H30BrClFN3O4/c1-14(2)17-9-7-8-15(3)22(17)33-23-19(10-18(29)20(28)21(23)30)32(24(34)25(33)35)13-16-11-31(12-16)26(36)37-27(4,5)6/h7-10,14,16H,11-13H2,1-6H3 |
| InChIKey | GDIOWIDGNNQSSB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 73.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.91 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|