C19H24N2O4 — CID 67130938
tert-butyl 3-[(7-methoxy-2-oxoquinolin-1-yl)methyl]azetidine-1-carboxylate (PubChem CID 67130938) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is tert-butyl 3-[(7-methoxy-2-oxoquinolin-1-yl)methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(7-methoxy-2-oxoquinolin-1-yl)methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 67130938 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | tert-butyl 3-[(7-methoxy-2-oxoquinolin-1-yl)methyl]azetidine-1-carboxylate |
| SMILES | COc1ccc2ccc(=O)n(CC3CN(C(=O)OC(C)(C)C)C3)c2c1 |
| InChI | InChI=1S/C19H24N2O4/c1-19(2,3)25-18(23)20-10-13(11-20)12-21-16-9-15(24-4)7-5-14(16)6-8-17(21)22/h5-9,13H,10-12H2,1-4H3 |
| InChIKey | DSPOBNIKKRWIGF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |