C21H29N3O4 — CID 146318904
tert-butyl (3R)-4-(6-methoxy-1-methylindole-2-carbonyl)-3-methylpiperazine-1-carboxylate (PubChem CID 146318904) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is tert-butyl (3R)-4-(6-methoxy-1-methylindole-2-carbonyl)-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3R)-4-(6-methoxy-1-methylindole-2-carbonyl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 146318904 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | tert-butyl (3R)-4-(6-methoxy-1-methylindole-2-carbonyl)-3-methylpiperazine-1-carboxylate |
| SMILES | COc1ccc2cc(C(=O)N3CCN(C(=O)OC(C)(C)C)C[C@H]3C)n(C)c2c1 |
| InChI | InChI=1S/C21H29N3O4/c1-14-13-23(20(26)28-21(2,3)4)9-10-24(14)19(25)18-11-15-7-8-16(27-6)12-17(15)22(18)5/h7-8,11-12,14H,9-10,13H2,1-6H3/t14-/m1/s1 |
| InChIKey | LHCDQTAVMGJYJA-CQSZACIVSA-N |
| XLogP | 3.27 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |