C21H28BrN3O3 — CID 171663032
tert-butyl (3R)-4-(7-bromo-1-ethylindole-2-carbonyl)-3-methylpiperazine-1-carboxylate (PubChem CID 171663032) has the molecular formula C21H28BrN3O3 and a molecular weight of 450.38 g/mol. Its IUPAC name is tert-butyl (3R)-4-(7-bromo-1-ethylindole-2-carbonyl)-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3R)-4-(7-bromo-1-ethylindole-2-carbonyl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 171663032 |
| Molecular Formula | C21H28BrN3O3 |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | tert-butyl (3R)-4-(7-bromo-1-ethylindole-2-carbonyl)-3-methylpiperazine-1-carboxylate |
| SMILES | CCn1c(C(=O)N2CCN(C(=O)OC(C)(C)C)C[C@H]2C)cc2cccc(Br)c21 |
| InChI | InChI=1S/C21H28BrN3O3/c1-6-24-17(12-15-8-7-9-16(22)18(15)24)19(26)25-11-10-23(13-14(25)2)20(27)28-21(3,4)5/h7-9,12,14H,6,10-11,13H2,1-5H3/t14-/m1/s1 |
| InChIKey | WTWTVTONWWJQAM-CQSZACIVSA-N |
| XLogP | 4.51 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |