C22H31N3O4 — CID 66774842
tert-butyl-[1-[2-(7-methoxy-2-oxoquinolin-1-yl)ethyl]piperidin-4-yl]carbamic acid (PubChem CID 66774842) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is tert-butyl-[1-[2-(7-methoxy-2-oxoquinolin-1-yl)ethyl]piperidin-4-yl]carbamic acid.
| Compound Name | tert-butyl-[1-[2-(7-methoxy-2-oxoquinolin-1-yl)ethyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 66774842 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | tert-butyl-[1-[2-(7-methoxy-2-oxoquinolin-1-yl)ethyl]piperidin-4-yl]carbamic acid |
| SMILES | COc1ccc2ccc(=O)n(CCN3CCC(N(C(=O)O)C(C)(C)C)CC3)c2c1 |
| InChI | InChI=1S/C22H31N3O4/c1-22(2,3)25(21(27)28)17-9-11-23(12-10-17)13-14-24-19-15-18(29-4)7-5-16(19)6-8-20(24)26/h5-8,15,17H,9-14H2,1-4H3,(H,27,28) |
| InChIKey | ZCZUWLPYOMMHEP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |