C20H27FN4O3 — CID 66773432
tert-butyl-[1-[2-(6-fluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamic acid (PubChem CID 66773432) has the molecular formula C20H27FN4O3 and a molecular weight of 390.46 g/mol. Its IUPAC name is tert-butyl-[1-[2-(6-fluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamic acid.
| Compound Name | tert-butyl-[1-[2-(6-fluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 66773432 |
| Molecular Formula | C20H27FN4O3 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | tert-butyl-[1-[2-(6-fluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1CCN(CCn2c(=O)cnc3cc(F)ccc32)CC1 |
| InChI | InChI=1S/C20H27FN4O3/c1-20(2,3)25(19(27)28)15-6-8-23(9-7-15)10-11-24-17-5-4-14(21)12-16(17)22-13-18(24)26/h4-5,12-13,15H,6-11H2,1-3H3,(H,27,28) |
| InChIKey | JHVMVOLGTYMZOL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |