C23H33N3O4 — CID 66774488
tert-butyl-[1-[2-(7-methoxy-2-oxoquinolin-1-yl)propyl]piperidin-4-yl]carbamic acid (PubChem CID 66774488) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is tert-butyl-[1-[2-(7-methoxy-2-oxoquinolin-1-yl)propyl]piperidin-4-yl]carbamic acid.
| Compound Name | tert-butyl-[1-[2-(7-methoxy-2-oxoquinolin-1-yl)propyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 66774488 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | tert-butyl-[1-[2-(7-methoxy-2-oxoquinolin-1-yl)propyl]piperidin-4-yl]carbamic acid |
| SMILES | COc1ccc2ccc(=O)n(C(C)CN3CCC(N(C(=O)O)C(C)(C)C)CC3)c2c1 |
| InChI | InChI=1S/C23H33N3O4/c1-16(25-20-14-19(30-5)8-6-17(20)7-9-21(25)27)15-24-12-10-18(11-13-24)26(22(28)29)23(2,3)4/h6-9,14,16,18H,10-13,15H2,1-5H3,(H,28,29) |
| InChIKey | VEJGNKMPYICKPY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |