C26H31N3O4 — CID 67025753
benzyl N-[4-[2-amino-2-(7-methoxy-2-oxoquinolin-1-yl)ethyl]cyclohexyl]carbamate (PubChem CID 67025753) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is benzyl N-[4-[2-amino-2-(7-methoxy-2-oxoquinolin-1-yl)ethyl]cyclohexyl]carbamate.
| Compound Name | benzyl N-[4-[2-amino-2-(7-methoxy-2-oxoquinolin-1-yl)ethyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 67025753 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | benzyl N-[4-[2-amino-2-(7-methoxy-2-oxoquinolin-1-yl)ethyl]cyclohexyl]carbamate |
| SMILES | COc1ccc2ccc(=O)n(C(N)CC3CCC(NC(=O)OCc4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C26H31N3O4/c1-32-22-13-9-20-10-14-25(30)29(23(20)16-22)24(27)15-18-7-11-21(12-8-18)28-26(31)33-17-19-5-3-2-4-6-19/h2-6,9-10,13-14,16,18,21,24H,7-8,11-12,15,17,27H2,1H3,(H,28,31) |
| InChIKey | YRPDOWLJRKVYDK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |