C17H19BrClFN2O4 — CID 146242675
tert-butyl 3-[(7-bromo-6-chloro-8-fluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]azetidine-1-carboxylate (PubChem CID 146242675) has the molecular formula C17H19BrClFN2O4 and a molecular weight of 449.70 g/mol. Its IUPAC name is tert-butyl 3-[(7-bromo-6-chloro-8-fluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(7-bromo-6-chloro-8-fluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 146242675 |
| Molecular Formula | C17H19BrClFN2O4 |
| Molecular Weight | 449.70 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | tert-butyl 3-[(7-bromo-6-chloro-8-fluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CN2C(=O)COc3c2cc(Cl)c(Br)c3F)C1 |
| InChI | InChI=1S/C17H19BrClFN2O4/c1-17(2,3)26-16(24)21-5-9(6-21)7-22-11-4-10(19)13(18)14(20)15(11)25-8-12(22)23/h4,9H,5-8H2,1-3H3 |
| InChIKey | MMAJUROQEJCBAN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.70 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|