C35H31ClN4O5 — CID 166816491
6-chloro-7-(3-hydroxynaphthalen-1-yl)-1-(2-morpholin-4-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione (PubChem CID 166816491) has the molecular formula C35H31ClN4O5 and a molecular weight of 623.11 g/mol. Its IUPAC name is 6-chloro-7-(3-hydroxynaphthalen-1-yl)-1-(2-morpholin-4-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione.
| Compound Name | 6-chloro-7-(3-hydroxynaphthalen-1-yl)-1-(2-morpholin-4-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 166816491 |
| Molecular Formula | C35H31ClN4O5 |
| Molecular Weight | 623.11 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | 6-chloro-7-(3-hydroxynaphthalen-1-yl)-1-(2-morpholin-4-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione |
| SMILES | C=CC(=O)N1CC(Cn2c(=O)c(=O)n(-c3ccccc3N3CCOCC3)c3cc(-c4cc(O)cc5ccccc45)c(Cl)cc32)C1 |
| InChI | InChI=1S/C35H31ClN4O5/c1-2-33(42)38-19-22(20-38)21-39-31-18-28(36)27(26-16-24(41)15-23-7-3-4-8-25(23)26)17-32(31)40(35(44)34(39)43)30-10-6-5-9-29(30)37-11-13-45-14-12-37/h2-10,15-18,22,41H,1,11-14,19-21H2 |
| InChIKey | JSWXIOQVKYENTF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.11 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|