C35H38ClN3O5 — CID 146242623
[4-[6-chloro-3-oxo-4-[(1-prop-2-enoylazetidin-3-yl)methyl]-2-(pyrrolidin-1-ylmethyl)-1,4-benzoxazin-7-yl]naphthalen-2-yl] 2,2-dimethylpropanoate (PubChem CID 146242623) has the molecular formula C35H38ClN3O5 and a molecular weight of 616.16 g/mol. Its IUPAC name is [4-[6-chloro-3-oxo-4-[(1-prop-2-enoylazetidin-3-yl)methyl]-2-(pyrrolidin-1-ylmethyl)-1,4-benzoxazin-7-yl]naphthalen-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-[6-chloro-3-oxo-4-[(1-prop-2-enoylazetidin-3-yl)methyl]-2-(pyrrolidin-1-ylmethyl)-1,4-benzoxazin-7-yl]naphthalen-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146242623 |
| Molecular Formula | C35H38ClN3O5 |
| Molecular Weight | 616.16 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | [4-[6-chloro-3-oxo-4-[(1-prop-2-enoylazetidin-3-yl)methyl]-2-(pyrrolidin-1-ylmethyl)-1,4-benzoxazin-7-yl]naphthalen-2-yl] 2,2-dimethylpropanoate |
| SMILES | C=CC(=O)N1CC(CN2C(=O)C(CN3CCCC3)Oc3cc(-c4cc(OC(=O)C(C)(C)C)cc5ccccc45)c(Cl)cc32)C1 |
| InChI | InChI=1S/C35H38ClN3O5/c1-5-32(40)38-18-22(19-38)20-39-29-17-28(36)27(16-30(29)44-31(33(39)41)21-37-12-8-9-13-37)26-15-24(43-34(42)35(2,3)4)14-23-10-6-7-11-25(23)26/h5-7,10-11,14-17,22,31H,1,8-9,12-13,18-21H2,2-4H3 |
| InChIKey | KNYFTWPCSYVWEB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.16 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|