C36H40ClN3O5 — CID 146242332
[4-[6-chloro-2-(1-methylpiperidin-4-yl)-3-oxo-4-[(1-prop-2-enoylazetidin-3-yl)methyl]-1,4-benzoxazin-7-yl]naphthalen-2-yl] 2,2-dimethylpropanoate (PubChem CID 146242332) has the molecular formula C36H40ClN3O5 and a molecular weight of 630.19 g/mol. Its IUPAC name is [4-[6-chloro-2-(1-methylpiperidin-4-yl)-3-oxo-4-[(1-prop-2-enoylazetidin-3-yl)methyl]-1,4-benzoxazin-7-yl]naphthalen-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-[6-chloro-2-(1-methylpiperidin-4-yl)-3-oxo-4-[(1-prop-2-enoylazetidin-3-yl)methyl]-1,4-benzoxazin-7-yl]naphthalen-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146242332 |
| Molecular Formula | C36H40ClN3O5 |
| Molecular Weight | 630.19 g/mol |
| Exact Mass | 629.27 |
| IUPAC Name | [4-[6-chloro-2-(1-methylpiperidin-4-yl)-3-oxo-4-[(1-prop-2-enoylazetidin-3-yl)methyl]-1,4-benzoxazin-7-yl]naphthalen-2-yl] 2,2-dimethylpropanoate |
| SMILES | C=CC(=O)N1CC(CN2C(=O)C(C3CCN(C)CC3)Oc3cc(-c4cc(OC(=O)C(C)(C)C)cc5ccccc45)c(Cl)cc32)C1 |
| InChI | InChI=1S/C36H40ClN3O5/c1-6-32(41)39-19-22(20-39)21-40-30-18-29(37)28(17-31(30)45-33(34(40)42)23-11-13-38(5)14-12-23)27-16-25(44-35(43)36(2,3)4)15-24-9-7-8-10-26(24)27/h6-10,15-18,22-23,33H,1,11-14,19-21H2,2-5H3 |
| InChIKey | XIXFMTPVTKCNQC-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.19 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|