C25H24N4O3 — CID 134413094
7-[(3-hydroxynaphthalen-1-yl)amino]-2-(1-prop-2-enoylpiperidin-3-yl)-3H-pyrrolo[3,4-c]pyridin-1-one (PubChem CID 134413094) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 7-[(3-hydroxynaphthalen-1-yl)amino]-2-(1-prop-2-enoylpiperidin-3-yl)-3H-pyrrolo[3,4-c]pyridin-1-one.
| Compound Name | 7-[(3-hydroxynaphthalen-1-yl)amino]-2-(1-prop-2-enoylpiperidin-3-yl)-3H-pyrrolo[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 134413094 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 7-[(3-hydroxynaphthalen-1-yl)amino]-2-(1-prop-2-enoylpiperidin-3-yl)-3H-pyrrolo[3,4-c]pyridin-1-one |
| SMILES | C=CC(=O)N1CCCC(N2Cc3cncc(Nc4cc(O)cc5ccccc45)c3C2=O)C1 |
| InChI | InChI=1S/C25H24N4O3/c1-2-23(31)28-9-5-7-18(15-28)29-14-17-12-26-13-22(24(17)25(29)32)27-21-11-19(30)10-16-6-3-4-8-20(16)21/h2-4,6,8,10-13,18,27,30H,1,5,7,9,14-15H2 |
| InChIKey | ALGOISZEJJZZNC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|