C19H24N4O — CID 175800541
1-[(3R)-3-[[(2-cyclopropyl-1H-pyrrolo[2,3-b]pyridin-4-yl)amino]methyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 175800541) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is 1-[(3R)-3-[[(2-cyclopropyl-1H-pyrrolo[2,3-b]pyridin-4-yl)amino]methyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[[(2-cyclopropyl-1H-pyrrolo[2,3-b]pyridin-4-yl)amino]methyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175800541 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-[(3R)-3-[[(2-cyclopropyl-1H-pyrrolo[2,3-b]pyridin-4-yl)amino]methyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@H](CNc2ccnc3[nH]c(C4CC4)cc23)C1 |
| InChI | InChI=1S/C19H24N4O/c1-2-18(24)23-9-3-4-13(12-23)11-21-16-7-8-20-19-15(16)10-17(22-19)14-5-6-14/h2,7-8,10,13-14H,1,3-6,9,11-12H2,(H2,20,21,22)/t13-/m1/s1 |
| InChIKey | WFESXYUZAXKSME-CYBMUJFWSA-N |
| XLogP | 3.28 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|