C17H22N4O2 — CID 175800471
1-[2-(hydroxymethyl)-3-[(1H-pyrrolo[2,3-b]pyridin-4-ylamino)methyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 175800471) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)-3-[(1H-pyrrolo[2,3-b]pyridin-4-ylamino)methyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[2-(hydroxymethyl)-3-[(1H-pyrrolo[2,3-b]pyridin-4-ylamino)methyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175800471 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1-[2-(hydroxymethyl)-3-[(1H-pyrrolo[2,3-b]pyridin-4-ylamino)methyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(CNc2ccnc3[nH]ccc23)C1CO |
| InChI | InChI=1S/C17H22N4O2/c1-2-16(23)21-9-3-4-12(15(21)11-22)10-20-14-6-8-19-17-13(14)5-7-18-17/h2,5-8,12,15,22H,1,3-4,9-11H2,(H2,18,19,20) |
| InChIKey | MQSDCSHPKRWZFY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|