C16H19FN4O — CID 170117075
1-[(2R,4R,5R)-4-fluoro-2-methyl-5-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)piperidin-1-yl]prop-2-en-1-one (PubChem CID 170117075) has the molecular formula C16H19FN4O and a molecular weight of 302.35 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-4-fluoro-2-methyl-5-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R,4R,5R)-4-fluoro-2-methyl-5-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170117075 |
| Molecular Formula | C16H19FN4O |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-[(2R,4R,5R)-4-fluoro-2-methyl-5-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@@H](Nc2ccnc3[nH]ccc23)[C@H](F)C[C@H]1C |
| InChI | InChI=1S/C16H19FN4O/c1-3-15(22)21-9-14(12(17)8-10(21)2)20-13-5-7-19-16-11(13)4-6-18-16/h3-7,10,12,14H,1,8-9H2,2H3,(H2,18,19,20)/t10-,12-,14-/m1/s1 |
| InChIKey | MXVYCFNDPKVXJT-MPKXVKKWSA-N |
| XLogP | 2.49 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|