C17H16N9O4S3- — CID 135150006
2-amino-1-[4-(2-carbamimidoyl-1,3-benzothiazol-4-yl)-2-sulfamoyl-3-(2H-tetrazol-5-yl)phenyl]ethanesulfinate (PubChem CID 135150006) has the molecular formula C17H16N9O4S3- and a molecular weight of 506.58 g/mol. Its IUPAC name is 2-amino-1-[4-(2-carbamimidoyl-1,3-benzothiazol-4-yl)-2-sulfamoyl-3-(2H-tetrazol-5-yl)phenyl]ethanesulfinate.
| Compound Name | 2-amino-1-[4-(2-carbamimidoyl-1,3-benzothiazol-4-yl)-2-sulfamoyl-3-(2H-tetrazol-5-yl)phenyl]ethanesulfinate |
|---|---|
| PubChem CID | 135150006 |
| Molecular Formula | C17H16N9O4S3- |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | 2-amino-1-[4-(2-carbamimidoyl-1,3-benzothiazol-4-yl)-2-sulfamoyl-3-(2H-tetrazol-5-yl)phenyl]ethanesulfinate |
| SMILES | [H]/N=C(\N)c1nc2c(-c3ccc(C(CN)S(=O)[O-])c(S(N)(=O)=O)c3-c3nn[nH]n3)cccc2s1 |
| InChI | InChI=1S/C17H17N9O4S3/c18-6-11(32(27)28)9-5-4-7(12(14(9)33(21,29)30)16-23-25-26-24-16)8-2-1-3-10-13(8)22-17(31-10)15(19)20/h1-5,11H,6,18H2,(H3,19,20)(H,27,28)(H2,21,29,30)(H,23,24,25,26)/p-1 |
| InChIKey | MWEBQQBAIJDYSL-UHFFFAOYSA-M |
| XLogP | -0.05 |
| TPSA | 243.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|