C11H17ClFNO2 — CID 135152108
tert-butyl 4-(chloromethyl)-5-fluoro-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 135152108) has the molecular formula C11H17ClFNO2 and a molecular weight of 249.71 g/mol. Its IUPAC name is tert-butyl 4-(chloromethyl)-5-fluoro-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-(chloromethyl)-5-fluoro-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 135152108 |
| Molecular Formula | C11H17ClFNO2 |
| Molecular Weight | 249.71 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | tert-butyl 4-(chloromethyl)-5-fluoro-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCl)=C(F)C1 |
| InChI | InChI=1S/C11H17ClFNO2/c1-11(2,3)16-10(15)14-5-4-8(6-12)9(13)7-14/h4-7H2,1-3H3 |
| InChIKey | ZIUGNLUCFYPYOH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.71 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|