C20H16F3N3 — CID 135153033
3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline (PubChem CID 135153033) has the molecular formula C20H16F3N3 and a molecular weight of 355.36 g/mol. Its IUPAC name is 3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline.
| Compound Name | 3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline |
|---|---|
| PubChem CID | 135153033 |
| Molecular Formula | C20H16F3N3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline |
| SMILES | CCC1(C)N=C(c2cc3cccc(F)c3nn2)c2ccccc2C1(F)F |
| InChI | InChI=1S/C20H16F3N3/c1-3-19(2)20(22,23)14-9-5-4-8-13(14)18(24-19)16-11-12-7-6-10-15(21)17(12)26-25-16/h4-11H,3H2,1-2H3 |
| InChIKey | VISIKEVXFSHMHJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |