About 3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline
3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline (PubChem CID 135153033) has the molecular formula C20H16F3N3
and a molecular weight of 355.36 g/mol. Its IUPAC name is 3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline.
Molecular Properties
| Compound Name | 3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline |
| PubChem CID | 135153033 |
| Molecular Formula | C20H16F3N3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline |
| SMILES | CCC1(C)N=C(c2cc3cccc(F)c3nn2)c2ccccc2C1(F)F |
| InChI | InChI=1S/C20H16F3N3/c1-3-19(2)20(22,23)14-9-5-4-8-13(14)18(24-19)16-11-12-7-6-10-15(21)17(12)26-25-16/h4-11H,3H2,1-2H3 |
| InChIKey | VISIKEVXFSHMHJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline?
The IUPAC name of 3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline (CID 135153033) is 3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline.
What is the SMILES notation for 3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline?
The canonical SMILES for 3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline is CCC1(C)N=C(c2cc3cccc(F)c3nn2)c2ccccc2C1(F)F.
What is the InChIKey of 3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline?
The InChIKey is VISIKEVXFSHMHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F3N3/c1-3-19(2)20(22,23)14-9-5-4-8-13(14)18(24-19)16-11-12-7-6-10-15(21)17(12)26-25-16/h4-11H,3H2,1-2H3.
What are the key properties of 3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline?
3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline has a molecular weight of 355.36 g/mol, XLogP of 4.88, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-ethyl-4,4-difluoro-3-methylisoquinolin-1-yl)-8-fluorocinnoline is sourced from PubChem (CID 135153033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).