C16H23F2N3OS — CID 135153488
N,N-dicyclohexyl-4-(difluoromethyl)thiadiazole-5-carboxamide (PubChem CID 135153488) has the molecular formula C16H23F2N3OS and a molecular weight of 343.44 g/mol. Its IUPAC name is N,N-dicyclohexyl-4-(difluoromethyl)thiadiazole-5-carboxamide.
| Compound Name | N,N-dicyclohexyl-4-(difluoromethyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 135153488 |
| Molecular Formula | C16H23F2N3OS |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N,N-dicyclohexyl-4-(difluoromethyl)thiadiazole-5-carboxamide |
| SMILES | O=C(c1snnc1C(F)F)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H23F2N3OS/c17-15(18)13-14(23-20-19-13)16(22)21(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-12,15H,1-10H2 |
| InChIKey | WVQOWSLMFRWWEL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |