C10H15N3OS — CID 2804319
N-cyclohexyl-4-methylthiadiazole-5-carboxamide (PubChem CID 2804319) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is N-cyclohexyl-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-cyclohexyl-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 2804319 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | N-cyclohexyl-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C10H15N3OS/c1-7-9(15-13-12-7)10(14)11-8-5-3-2-4-6-8/h8H,2-6H2,1H3,(H,11,14) |
| InChIKey | ICNCWFGLFARJBP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |