C21H16ClNO2S — CID 135153899
4-[3-(5-chlorothiophen-2-yl)-5-pyridin-4-yl-1-benzofuran-2-yl]butan-2-one (PubChem CID 135153899) has the molecular formula C21H16ClNO2S and a molecular weight of 381.88 g/mol. Its IUPAC name is 4-[3-(5-chlorothiophen-2-yl)-5-pyridin-4-yl-1-benzofuran-2-yl]butan-2-one.
| Compound Name | 4-[3-(5-chlorothiophen-2-yl)-5-pyridin-4-yl-1-benzofuran-2-yl]butan-2-one |
|---|---|
| PubChem CID | 135153899 |
| Molecular Formula | C21H16ClNO2S |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 4-[3-(5-chlorothiophen-2-yl)-5-pyridin-4-yl-1-benzofuran-2-yl]butan-2-one |
| SMILES | CC(=O)CCc1oc2ccc(-c3ccncc3)cc2c1-c1ccc(Cl)s1 |
| InChI | InChI=1S/C21H16ClNO2S/c1-13(24)2-4-18-21(19-6-7-20(22)26-19)16-12-15(3-5-17(16)25-18)14-8-10-23-11-9-14/h3,5-12H,2,4H2,1H3 |
| InChIKey | PHBWVDZFCIXLEC-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |