C21H23ClN2O4 — CID 135154002
methyl 2-chloro-6-[4-(1,3-dihydro-2-benzofuran-5-yloxy)piperidin-1-yl]-5-methylpyridine-3-carboxylate (PubChem CID 135154002) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is methyl 2-chloro-6-[4-(1,3-dihydro-2-benzofuran-5-yloxy)piperidin-1-yl]-5-methylpyridine-3-carboxylate.
| Compound Name | methyl 2-chloro-6-[4-(1,3-dihydro-2-benzofuran-5-yloxy)piperidin-1-yl]-5-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 135154002 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | methyl 2-chloro-6-[4-(1,3-dihydro-2-benzofuran-5-yloxy)piperidin-1-yl]-5-methylpyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(C)c(N2CCC(Oc3ccc4c(c3)COC4)CC2)nc1Cl |
| InChI | InChI=1S/C21H23ClN2O4/c1-13-9-18(21(25)26-2)19(22)23-20(13)24-7-5-16(6-8-24)28-17-4-3-14-11-27-12-15(14)10-17/h3-4,9-10,16H,5-8,11-12H2,1-2H3 |
| InChIKey | IKICEXTUZCJZQF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|