C24H28N4O3 — CID 135154834
(1R)-4-[4-(1,3-dihydro-2-benzofuran-5-yloxy)piperidin-1-yl]-5-methyl-3,9,12-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-8-one (PubChem CID 135154834) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is (1R)-4-[4-(1,3-dihydro-2-benzofuran-5-yloxy)piperidin-1-yl]-5-methyl-3,9,12-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-8-one.
| Compound Name | (1R)-4-[4-(1,3-dihydro-2-benzofuran-5-yloxy)piperidin-1-yl]-5-methyl-3,9,12-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 135154834 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (1R)-4-[4-(1,3-dihydro-2-benzofuran-5-yloxy)piperidin-1-yl]-5-methyl-3,9,12-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-8-one |
| SMILES | Cc1cc2c(nc1N1CCC(Oc3ccc4c(c3)COC4)CC1)[C@H]1CNCCN1C2=O |
| InChI | InChI=1S/C24H28N4O3/c1-15-10-20-22(21-12-25-6-9-28(21)24(20)29)26-23(15)27-7-4-18(5-8-27)31-19-3-2-16-13-30-14-17(16)11-19/h2-3,10-11,18,21,25H,4-9,12-14H2,1H3/t21-/m1/s1 |
| InChIKey | JJMIZCYQKRZEDK-OAQYLSRUSA-N |
| XLogP | 2.57 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |