C16H19N5O4 — CID 135154613
6-[4-[(6-methoxy-3-pyridinyl)oxy]piperidin-1-yl]-3-nitropyridin-2-amine (PubChem CID 135154613) has the molecular formula C16H19N5O4 and a molecular weight of 345.36 g/mol. Its IUPAC name is 6-[4-[(6-methoxy-3-pyridinyl)oxy]piperidin-1-yl]-3-nitropyridin-2-amine.
| Compound Name | 6-[4-[(6-methoxy-3-pyridinyl)oxy]piperidin-1-yl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 135154613 |
| Molecular Formula | C16H19N5O4 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 6-[4-[(6-methoxy-3-pyridinyl)oxy]piperidin-1-yl]-3-nitropyridin-2-amine |
| SMILES | COc1ccc(OC2CCN(c3ccc([N+](=O)[O-])c(N)n3)CC2)cn1 |
| InChI | InChI=1S/C16H19N5O4/c1-24-15-5-2-12(10-18-15)25-11-6-8-20(9-7-11)14-4-3-13(21(22)23)16(17)19-14/h2-5,10-11H,6-9H2,1H3,(H2,17,19) |
| InChIKey | XINAWIYCMZIOIT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|