C30H26F3N7O2 — CID 135155719
2-amino-3-[[3-[5-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]phenyl]methyl]-5,5-diphenylimidazol-4-one (PubChem CID 135155719) has the molecular formula C30H26F3N7O2 and a molecular weight of 573.58 g/mol. Its IUPAC name is 2-amino-3-[[3-[5-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]phenyl]methyl]-5,5-diphenylimidazol-4-one.
| Compound Name | 2-amino-3-[[3-[5-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]phenyl]methyl]-5,5-diphenylimidazol-4-one |
|---|---|
| PubChem CID | 135155719 |
| Molecular Formula | C30H26F3N7O2 |
| Molecular Weight | 573.58 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | 2-amino-3-[[3-[5-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]phenyl]methyl]-5,5-diphenylimidazol-4-one |
| SMILES | CC1CN(C(=O)c2cccc(CN3C(=O)C(c4ccccc4)(c4ccccc4)N=C3N)c2)Cc2nnc(C(F)(F)F)n21 |
| InChI | InChI=1S/C30H26F3N7O2/c1-19-16-38(18-24-36-37-26(40(19)24)30(31,32)33)25(41)21-10-8-9-20(15-21)17-39-27(42)29(35-28(39)34,22-11-4-2-5-12-22)23-13-6-3-7-14-23/h2-15,19H,16-18H2,1H3,(H2,34,35) |
| InChIKey | UYBBQARKPWEAPK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 109.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |