C18H14N2O — CID 135159479
8-methyl-5-phenylpyrido[2,3-b][1,4]benzoxazine (PubChem CID 135159479) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is 8-methyl-5-phenylpyrido[2,3-b][1,4]benzoxazine.
| Compound Name | 8-methyl-5-phenylpyrido[2,3-b][1,4]benzoxazine |
|---|---|
| PubChem CID | 135159479 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 8-methyl-5-phenylpyrido[2,3-b][1,4]benzoxazine |
| SMILES | Cc1ccc2c(c1)Oc1ncccc1N2c1ccccc1 |
| InChI | InChI=1S/C18H14N2O/c1-13-9-10-15-17(12-13)21-18-16(8-5-11-19-18)20(15)14-6-3-2-4-7-14/h2-12H,1H3 |
| InChIKey | CBYMSSYXPSHKPF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |