C18H16N4O — CID 59572809
2-(2,4,6-trimethylphenyl)-9-oxa-2,4,7,11-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3,5,7,11,13-hexaene (PubChem CID 59572809) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)-9-oxa-2,4,7,11-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3,5,7,11,13-hexaene.
| Compound Name | 2-(2,4,6-trimethylphenyl)-9-oxa-2,4,7,11-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3,5,7,11,13-hexaene |
|---|---|
| PubChem CID | 59572809 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)-9-oxa-2,4,7,11-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3,5,7,11,13-hexaene |
| SMILES | Cc1cc(C)c(N2c3cccnc3Oc3nccnc32)c(C)c1 |
| InChI | InChI=1S/C18H16N4O/c1-11-9-12(2)15(13(3)10-11)22-14-5-4-6-20-17(14)23-18-16(22)19-7-8-21-18/h4-10H,1-3H3 |
| InChIKey | ISMITHLZJGGYFB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |