C28H32FN7O2S2 — CID 135160034
[6-[(1-ethylpyrazol-4-yl)oxysulfanyl-methylamino]-1-(4-fluorocyclohexa-1,3-dien-1-yl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone;sulfane (PubChem CID 135160034) has the molecular formula C28H32FN7O2S2 and a molecular weight of 581.74 g/mol. Its IUPAC name is [6-[(1-ethylpyrazol-4-yl)oxysulfanyl-methylamino]-1-(4-fluorocyclohexa-1,3-dien-1-yl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone;sulfane.
| Compound Name | [6-[(1-ethylpyrazol-4-yl)oxysulfanyl-methylamino]-1-(4-fluorocyclohexa-1,3-dien-1-yl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone;sulfane |
|---|---|
| PubChem CID | 135160034 |
| Molecular Formula | C28H32FN7O2S2 |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | [6-[(1-ethylpyrazol-4-yl)oxysulfanyl-methylamino]-1-(4-fluorocyclohexa-1,3-dien-1-yl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone;sulfane |
| SMILES | CCn1cc(OSN(C)N2CCC3=Cc4c(cnn4C4=CC=C(F)CC4)CC3(C(=O)c3ccccn3)C2)cn1.S |
| InChI | InChI=1S/C28H30FN7O2S.H2S/c1-3-34-18-24(17-31-34)38-39-33(2)35-13-11-21-14-26-20(16-32-36(26)23-9-7-22(29)8-10-23)15-28(21,19-35)27(37)25-6-4-5-12-30-25;/h4-7,9,12,14,16-18H,3,8,10-11,13,15,19H2,1-2H3;1H2 |
| InChIKey | XYJMVLGTXMSGGV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 81.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|