C25H23FN6OS2 — CID 135160032
[6-(2-ethylpyrazol-3-yl)sulfanyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 135160032) has the molecular formula C25H23FN6OS2 and a molecular weight of 506.63 g/mol. Its IUPAC name is [6-(2-ethylpyrazol-3-yl)sulfanyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [6-(2-ethylpyrazol-3-yl)sulfanyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 135160032 |
| Molecular Formula | C25H23FN6OS2 |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | [6-(2-ethylpyrazol-3-yl)sulfanyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | CCn1nccc1SN1CCC2=Cc3c(cnn3-c3ccc(F)cc3)CC2(C(=O)c2cscn2)C1 |
| InChI | InChI=1S/C25H23FN6OS2/c1-2-31-23(7-9-28-31)35-30-10-8-18-11-22-17(13-29-32(22)20-5-3-19(26)4-6-20)12-25(18,15-30)24(33)21-14-34-16-27-21/h3-7,9,11,13-14,16H,2,8,10,12,15H2,1H3 |
| InChIKey | MCFZLXYKOQITSS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|