C32H28F3N5OS — CID 135160033
[6-(3,4-difluorophenyl)sulfanyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(2-pyrrolidin-1-yl-4-pyridinyl)methanone (PubChem CID 135160033) has the molecular formula C32H28F3N5OS and a molecular weight of 587.67 g/mol. Its IUPAC name is [6-(3,4-difluorophenyl)sulfanyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(2-pyrrolidin-1-yl-4-pyridinyl)methanone.
| Compound Name | [6-(3,4-difluorophenyl)sulfanyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(2-pyrrolidin-1-yl-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 135160033 |
| Molecular Formula | C32H28F3N5OS |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | [6-(3,4-difluorophenyl)sulfanyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(2-pyrrolidin-1-yl-4-pyridinyl)methanone |
| SMILES | O=C(c1ccnc(N2CCCC2)c1)C12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCN(Sc1ccc(F)c(F)c1)C2 |
| InChI | InChI=1S/C32H28F3N5OS/c33-24-3-5-25(6-4-24)40-29-16-23-10-14-39(42-26-7-8-27(34)28(35)17-26)20-32(23,18-22(29)19-37-40)31(41)21-9-11-36-30(15-21)38-12-1-2-13-38/h3-9,11,15-17,19H,1-2,10,12-14,18,20H2 |
| InChIKey | XHLMHKFGZIUQHU-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|