C22H18ClFN4OS — CID 135159891
6-[(6-chloro-3-pyridinyl)sulfanyl]-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinoline-4a-carbaldehyde (PubChem CID 135159891) has the molecular formula C22H18ClFN4OS and a molecular weight of 440.93 g/mol. Its IUPAC name is 6-[(6-chloro-3-pyridinyl)sulfanyl]-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinoline-4a-carbaldehyde.
| Compound Name | 6-[(6-chloro-3-pyridinyl)sulfanyl]-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinoline-4a-carbaldehyde |
|---|---|
| PubChem CID | 135159891 |
| Molecular Formula | C22H18ClFN4OS |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 6-[(6-chloro-3-pyridinyl)sulfanyl]-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinoline-4a-carbaldehyde |
| SMILES | O=CC12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCN(Sc1ccc(Cl)nc1)C2 |
| InChI | InChI=1S/C22H18ClFN4OS/c23-21-6-5-19(12-25-21)30-27-8-7-16-9-20-15(10-22(16,13-27)14-29)11-26-28(20)18-3-1-17(24)2-4-18/h1-6,9,11-12,14H,7-8,10,13H2 |
| InChIKey | SLBUFVIXMDXYCE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|