C22H27FN6OS — CID 135159998
6-[(E)-2-amino-1-[amino(propan-2-yl)amino]ethenyl]sulfanyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinoline-4a-carbaldehyde (PubChem CID 135159998) has the molecular formula C22H27FN6OS and a molecular weight of 442.56 g/mol. Its IUPAC name is 6-[(E)-2-amino-1-[amino(propan-2-yl)amino]ethenyl]sulfanyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinoline-4a-carbaldehyde.
| Compound Name | 6-[(E)-2-amino-1-[amino(propan-2-yl)amino]ethenyl]sulfanyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinoline-4a-carbaldehyde |
|---|---|
| PubChem CID | 135159998 |
| Molecular Formula | C22H27FN6OS |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 6-[(E)-2-amino-1-[amino(propan-2-yl)amino]ethenyl]sulfanyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinoline-4a-carbaldehyde |
| SMILES | CC(C)N(N)/C(=C\N)SN1CCC2=Cc3c(cnn3-c3ccc(F)cc3)CC2(C=O)C1 |
| InChI | InChI=1S/C22H27FN6OS/c1-15(2)28(25)21(11-24)31-27-8-7-17-9-20-16(10-22(17,13-27)14-30)12-26-29(20)19-5-3-18(23)4-6-19/h3-6,9,11-12,14-15H,7-8,10,13,24-25H2,1-2H3/b21-11+ |
| InChIKey | WXCMYTAMEAXRQH-SRZZPIQSSA-N |
| XLogP | 2.83 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|