C19H22FN3 — CID 58622938
(4aS,5R)-1-(4-fluorophenyl)-N,N,4a-trimethyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-amine (PubChem CID 58622938) has the molecular formula C19H22FN3 and a molecular weight of 311.40 g/mol. Its IUPAC name is (4aS,5R)-1-(4-fluorophenyl)-N,N,4a-trimethyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-amine.
| Compound Name | (4aS,5R)-1-(4-fluorophenyl)-N,N,4a-trimethyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-amine |
|---|---|
| PubChem CID | 58622938 |
| Molecular Formula | C19H22FN3 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | (4aS,5R)-1-(4-fluorophenyl)-N,N,4a-trimethyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-amine |
| SMILES | CN(C)[C@@H]1CCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@@]21C |
| InChI | InChI=1S/C19H22FN3/c1-19-11-13-12-21-23(16-7-5-15(20)6-8-16)17(13)10-14(19)4-9-18(19)22(2)3/h5-8,10,12,18H,4,9,11H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | FAIMUEMOVGZAGZ-MOPGFXCFSA-N |
| XLogP | 3.68 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |