C26H28FN3 — CID 58242824
(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5-(4-pyridin-2-ylbutyl)-4,5,6,7-tetrahydrocyclopenta[f]indazole (PubChem CID 58242824) has the molecular formula C26H28FN3 and a molecular weight of 401.53 g/mol. Its IUPAC name is (4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5-(4-pyridin-2-ylbutyl)-4,5,6,7-tetrahydrocyclopenta[f]indazole.
| Compound Name | (4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5-(4-pyridin-2-ylbutyl)-4,5,6,7-tetrahydrocyclopenta[f]indazole |
|---|---|
| PubChem CID | 58242824 |
| Molecular Formula | C26H28FN3 |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | (4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5-(4-pyridin-2-ylbutyl)-4,5,6,7-tetrahydrocyclopenta[f]indazole |
| SMILES | C[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CC[C@@H]2CCCCc1ccccn1 |
| InChI | InChI=1S/C26H28FN3/c1-26-17-19-18-29-30(24-13-11-22(27)12-14-24)25(19)16-21(26)10-9-20(26)6-2-3-7-23-8-4-5-15-28-23/h4-5,8,11-16,18,20H,2-3,6-7,9-10,17H2,1H3/t20-,26+/m0/s1 |
| InChIKey | QMFOAKRKOAHXBI-RXFWQSSRSA-N |
| XLogP | 6.18 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|