C32H35FN4O — CID 70973347
N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]methyl]-3,5-dimethyl-N-(3-phenylpropyl)-1,2-oxazol-4-amine (PubChem CID 70973347) has the molecular formula C32H35FN4O and a molecular weight of 510.66 g/mol. Its IUPAC name is N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]methyl]-3,5-dimethyl-N-(3-phenylpropyl)-1,2-oxazol-4-amine.
| Compound Name | N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]methyl]-3,5-dimethyl-N-(3-phenylpropyl)-1,2-oxazol-4-amine |
|---|---|
| PubChem CID | 70973347 |
| Molecular Formula | C32H35FN4O |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]methyl]-3,5-dimethyl-N-(3-phenylpropyl)-1,2-oxazol-4-amine |
| SMILES | Cc1noc(C)c1N(CCCc1ccccc1)C[C@H]1CCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@@]21C |
| InChI | InChI=1S/C32H35FN4O/c1-22-31(23(2)38-35-22)36(17-7-10-24-8-5-4-6-9-24)21-27-12-11-26-18-30-25(19-32(26,27)3)20-34-37(30)29-15-13-28(33)14-16-29/h4-6,8-9,13-16,18,20,27H,7,10-12,17,19,21H2,1-3H3/t27-,32+/m1/s1 |
| InChIKey | PKSLFWCMAYRHDA-ZUKKLESISA-N |
| XLogP | 7.11 |
| TPSA | 47.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |