C22H25FN2 — CID 89326790
(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5-pent-4-enyl-4,5,6,7-tetrahydrocyclopenta[f]indazole (PubChem CID 89326790) has the molecular formula C22H25FN2 and a molecular weight of 336.45 g/mol. Its IUPAC name is (4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5-pent-4-enyl-4,5,6,7-tetrahydrocyclopenta[f]indazole.
| Compound Name | (4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5-pent-4-enyl-4,5,6,7-tetrahydrocyclopenta[f]indazole |
|---|---|
| PubChem CID | 89326790 |
| Molecular Formula | C22H25FN2 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5-pent-4-enyl-4,5,6,7-tetrahydrocyclopenta[f]indazole |
| SMILES | C=CCCC[C@H]1CCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@@]21C |
| InChI | InChI=1S/C22H25FN2/c1-3-4-5-6-17-7-8-18-13-21-16(14-22(17,18)2)15-24-25(21)20-11-9-19(23)10-12-20/h3,9-13,15,17H,1,4-8,14H2,2H3/t17-,22+/m0/s1 |
| InChIKey | QMOKIANRQHLOBV-HTAPYJJXSA-N |
| XLogP | 5.72 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|