C24H28FN3O — CID 58980174
N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]methyl]pent-4-enamide (PubChem CID 58980174) has the molecular formula C24H28FN3O and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]methyl]pent-4-enamide.
| Compound Name | N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]methyl]pent-4-enamide |
|---|---|
| PubChem CID | 58980174 |
| Molecular Formula | C24H28FN3O |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]methyl]pent-4-enamide |
| SMILES | C=CCCC(=O)NC[C@H]1CCCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@@]21C |
| InChI | InChI=1S/C24H28FN3O/c1-3-4-8-23(29)26-16-19-7-5-6-18-13-22-17(14-24(18,19)2)15-27-28(22)21-11-9-20(25)10-12-21/h3,9-13,15,19H,1,4-8,14,16H2,2H3,(H,26,29)/t19-,24+/m1/s1 |
| InChIKey | QXZAWOMXMGOTPO-DVECYGJZSA-N |
| XLogP | 4.84 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|