C19H20FN5 — CID 58980177
(4aR,5S)-5-(azidomethyl)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazole (PubChem CID 58980177) has the molecular formula C19H20FN5 and a molecular weight of 337.40 g/mol. Its IUPAC name is (4aR,5S)-5-(azidomethyl)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazole.
| Compound Name | (4aR,5S)-5-(azidomethyl)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazole |
|---|---|
| PubChem CID | 58980177 |
| Molecular Formula | C19H20FN5 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (4aR,5S)-5-(azidomethyl)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazole |
| SMILES | C[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCC[C@@H]2CN=[N+]=[N-] |
| InChI | InChI=1S/C19H20FN5/c1-19-10-13-11-23-25(17-7-5-16(20)6-8-17)18(13)9-14(19)3-2-4-15(19)12-22-24-21/h5-9,11,15H,2-4,10,12H2,1H3/t15-,19+/m1/s1 |
| InChIKey | TXHZDGNCZHJORM-BEFAXECRSA-N |
| XLogP | 5.07 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|