C21H25FN2O — CID 142819397
ethane;1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazole-5-carbaldehyde (PubChem CID 142819397) has the molecular formula C21H25FN2O and a molecular weight of 340.44 g/mol. Its IUPAC name is ethane;1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazole-5-carbaldehyde.
| Compound Name | ethane;1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazole-5-carbaldehyde |
|---|---|
| PubChem CID | 142819397 |
| Molecular Formula | C21H25FN2O |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | ethane;1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazole-5-carbaldehyde |
| SMILES | CC.CC12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCCC2C=O |
| InChI | InChI=1S/C19H19FN2O.C2H6/c1-19-10-13-11-21-22(17-7-5-16(20)6-8-17)18(13)9-14(19)3-2-4-15(19)12-23;1-2/h5-9,11-12,15H,2-4,10H2,1H3;1-2H3 |
| InChIKey | ARPLPQDCCGFZKI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|